C17H14FNO4S — CID 110277003
(4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-methyl-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 110277003) has the molecular formula C17H14FNO4S and a molecular weight of 347.37 g/mol. Its IUPAC name is (4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-methyl-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-methyl-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 110277003 |
| Molecular Formula | C17H14FNO4S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (4E)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-methyl-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(F)cc1/C(O)=C1\C(=O)C(=O)N(C)C1c1cccs1 |
| InChI | InChI=1S/C17H14FNO4S/c1-19-14(12-4-3-7-24-12)13(16(21)17(19)22)15(20)10-8-9(18)5-6-11(10)23-2/h3-8,14,20H,1-2H3/b15-13+ |
| InChIKey | APNXBPJPGFRRCT-FYWRMAATSA-N |
| XLogP | 2.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|