C24H29FN4O3 — CID 110277120
(4E)-5-(4-fluorophenyl)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-(2-piperidin-1-ylethyl)pyrrolidine-2,3-dione (PubChem CID 110277120) has the molecular formula C24H29FN4O3 and a molecular weight of 440.52 g/mol. Its IUPAC name is (4E)-5-(4-fluorophenyl)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-(2-piperidin-1-ylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-fluorophenyl)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-(2-piperidin-1-ylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 110277120 |
| Molecular Formula | C24H29FN4O3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (4E)-5-(4-fluorophenyl)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-1-(2-piperidin-1-ylethyl)pyrrolidine-2,3-dione |
| SMILES | Cc1nn(C)c(C)c1/C(O)=C1\C(=O)C(=O)N(CCN2CCCCC2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FN4O3/c1-15-19(16(2)27(3)26-15)22(30)20-21(17-7-9-18(25)10-8-17)29(24(32)23(20)31)14-13-28-11-5-4-6-12-28/h7-10,21,30H,4-6,11-14H2,1-3H3/b22-20+ |
| InChIKey | LSPYVGSQHCREBV-LSDHQDQOSA-N |
| XLogP | 3.08 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|