C27H31FN2O7 — CID 110277341
(4E)-4-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-pyrrolidin-1-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 110277341) has the molecular formula C27H31FN2O7 and a molecular weight of 514.55 g/mol. Its IUPAC name is (4E)-4-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-pyrrolidin-1-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-pyrrolidin-1-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 110277341 |
| Molecular Formula | C27H31FN2O7 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (4E)-4-[(3-fluoro-4-methoxyphenyl)-hydroxymethylidene]-1-(2-pyrrolidin-1-ylethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(CCN3CCCC3)C2c2cc(OC)c(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C27H31FN2O7/c1-34-19-8-7-16(13-18(19)28)24(31)22-23(17-14-20(35-2)26(37-4)21(15-17)36-3)30(27(33)25(22)32)12-11-29-9-5-6-10-29/h7-8,13-15,23,31H,5-6,9-12H2,1-4H3/b24-22+ |
| InChIKey | UBHDWXJYCLFTDM-ZNTNEXAZSA-N |
| XLogP | 3.38 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|