About 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one
2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 110278011) has the molecular formula C18H18ClFN4OS
and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 110278011 |
| Molecular Formula | C18H18ClFN4OS |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | NC1CCCN(c2nc3ccsc3c(=O)n2Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C18H18ClFN4OS/c19-13-4-1-5-14(20)12(13)10-24-17(25)16-15(6-8-26-16)22-18(24)23-7-2-3-11(21)9-23/h1,4-6,8,11H,2-3,7,9-10,21H2 |
| InChIKey | YBZVUNYBYBCUBZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one (CID 110278011) is 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one is NC1CCCN(c2nc3ccsc3c(=O)n2Cc2c(F)cccc2Cl)C1.
What is the InChIKey of 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one?
The InChIKey is YBZVUNYBYBCUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClFN4OS/c19-13-4-1-5-14(20)12(13)10-24-17(25)16-15(6-8-26-16)22-18(24)23-7-2-3-11(21)9-23/h1,4-6,8,11H,2-3,7,9-10,21H2.
What are the key properties of 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one?
2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one has a molecular weight of 392.89 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopiperidin-1-yl)-3-[(2-chloro-6-fluorophenyl)methyl]thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 110278011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).