C17H15ClN2O2S — CID 110278921
N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-chloro-5-methylsulfanylbenzamide (PubChem CID 110278921) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-chloro-5-methylsulfanylbenzamide.
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-chloro-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 110278921 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)ethyl]-2-chloro-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NC(C)c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-10(17-20-14-5-3-4-6-15(14)22-17)19-16(21)12-9-11(23-2)7-8-13(12)18/h3-10H,1-2H3,(H,19,21) |
| InChIKey | NACRVFMXCWITFR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |