C19H24N2O2 — CID 110282100
tert-butyl N-[[3-[3-(aminomethyl)phenyl]phenyl]methyl]carbamate (PubChem CID 110282100) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl N-[[3-[3-(aminomethyl)phenyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[3-(aminomethyl)phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 110282100 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl N-[[3-[3-(aminomethyl)phenyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-19(2,3)23-18(22)21-13-15-7-5-9-17(11-15)16-8-4-6-14(10-16)12-20/h4-11H,12-13,20H2,1-3H3,(H,21,22) |
| InChIKey | ZJSHRYNHCHUIBJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |