C12H10F2N2 — CID 110282116
[2-(3,5-difluorophenyl)-3-pyridinyl]methanamine (PubChem CID 110282116) has the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. Its IUPAC name is [2-(3,5-difluorophenyl)-3-pyridinyl]methanamine.
| Compound Name | [2-(3,5-difluorophenyl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 110282116 |
| Molecular Formula | C12H10F2N2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | [2-(3,5-difluorophenyl)-3-pyridinyl]methanamine |
| SMILES | NCc1cccnc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H10F2N2/c13-10-4-9(5-11(14)6-10)12-8(7-15)2-1-3-16-12/h1-6H,7,15H2 |
| InChIKey | DMTBUXBEUPIGLR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |