C32H35NO9 — CID 11028239
methyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3-oxobutanoate (PubChem CID 11028239) has the molecular formula C32H35NO9 and a molecular weight of 577.63 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3-oxobutanoate.
| Compound Name | methyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 11028239 |
| Molecular Formula | C32H35NO9 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | methyl 2-[(2S,3S,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-3-oxobutanoate |
| SMILES | COC(=O)C(C(C)=O)[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C32H35NO9/c1-22(34)27(32(35)38-2)30-28(33(36)37)31(41-20-25-16-10-5-11-17-25)29(40-19-24-14-8-4-9-15-24)26(42-30)21-39-18-23-12-6-3-7-13-23/h3-17,26-31H,18-21H2,1-2H3/t26-,27?,28+,29+,30+,31-/m1/s1 |
| InChIKey | WRCCQCLMOZKPTR-GIPKAJOWSA-N |
| XLogP | 4.16 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|