C37H60O3Si — CID 11028270
methyl (3R,7R,11S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,7,11,15-tetramethylhexadecanoate (PubChem CID 11028270) has the molecular formula C37H60O3Si and a molecular weight of 580.97 g/mol. Its IUPAC name is methyl (3R,7R,11S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,7,11,15-tetramethylhexadecanoate.
| Compound Name | methyl (3R,7R,11S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,7,11,15-tetramethylhexadecanoate |
|---|---|
| PubChem CID | 11028270 |
| Molecular Formula | C37H60O3Si |
| Molecular Weight | 580.97 g/mol |
| Exact Mass | 580.43 |
| IUPAC Name | methyl (3R,7R,11S,15S)-16-[tert-butyl(diphenyl)silyl]oxy-3,7,11,15-tetramethylhexadecanoate |
| SMILES | COC(=O)C[C@H](C)CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H60O3Si/c1-30(20-16-22-32(3)28-36(38)39-8)18-15-19-31(2)21-17-23-33(4)29-40-41(37(5,6)7,34-24-11-9-12-25-34)35-26-13-10-14-27-35/h9-14,24-27,30-33H,15-23,28-29H2,1-8H3/t30-,31+,32-,33+/m1/s1 |
| InChIKey | FPWIWQGWQLZBTM-LVVLYVGBSA-N |
| XLogP | 9.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.97 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|