About 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride
2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride (PubChem CID 110283411) has the molecular formula C13H24ClN3O2
and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride |
| PubChem CID | 110283411 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride |
| SMILES | CN(C)C(=O)CC1NCCN(CC2CCC2)C1=O.Cl |
| InChI | InChI=1S/C13H23N3O2.ClH/c1-15(2)12(17)8-11-13(18)16(7-6-14-11)9-10-4-3-5-10;/h10-11,14H,3-9H2,1-2H3;1H |
| InChIKey | VNOIUIITLCWJHS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride?
The IUPAC name of 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride (CID 110283411) is 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride.
What is the SMILES notation for 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride?
The canonical SMILES for 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride is CN(C)C(=O)CC1NCCN(CC2CCC2)C1=O.Cl.
What is the InChIKey of 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride?
The InChIKey is VNOIUIITLCWJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2.ClH/c1-15(2)12(17)8-11-13(18)16(7-6-14-11)9-10-4-3-5-10;/h10-11,14H,3-9H2,1-2H3;1H.
What are the key properties of 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride?
2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride has a molecular weight of 289.81 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(cyclobutylmethyl)-3-oxopiperazin-2-yl]-N,N-dimethylacetamide;hydrochloride is sourced from PubChem (CID 110283411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).