C28H49BrO7Si — CID 11028423
ethyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate (PubChem CID 11028423) has the molecular formula C28H49BrO7Si and a molecular weight of 605.68 g/mol. Its IUPAC name is ethyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 11028423 |
| Molecular Formula | C28H49BrO7Si |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | ethyl 2-[(2S,4R,6R)-6-[(1R,2E,4E,6R,8E)-9-bromo-1-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3-methylnona-2,4,8-trienyl]-2,4-dimethoxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@]1(OC)C[C@H](OC)C[C@H]([C@@H](/C=C(C)/C=C/[C@@H](C/C=C/Br)OC)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H49BrO7Si/c1-11-34-26(30)20-28(33-8)19-23(32-7)18-24(35-28)25(36-37(9,10)27(3,4)5)17-21(2)14-15-22(31-6)13-12-16-29/h12,14-17,22-25H,11,13,18-20H2,1-10H3/b15-14+,16-12+,21-17+/t22-,23-,24-,25-,28+/m1/s1 |
| InChIKey | GRXQENCHVLJEIJ-CDKYRECQSA-N |
| XLogP | 6.68 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|