C22H17BrCo2O8 — CID 11028437
carbon monoxide;cobalt;methyl 2-bromo-2-[(1R,2R)-2-(2-phenylethynyl)cyclopentyl]acetate (PubChem CID 11028437) has the molecular formula C22H17BrCo2O8 and a molecular weight of 607.14 g/mol. Its IUPAC name is carbon monoxide;cobalt;methyl 2-bromo-2-[(1R,2R)-2-(2-phenylethynyl)cyclopentyl]acetate.
| Compound Name | carbon monoxide;cobalt;methyl 2-bromo-2-[(1R,2R)-2-(2-phenylethynyl)cyclopentyl]acetate |
|---|---|
| PubChem CID | 11028437 |
| Molecular Formula | C22H17BrCo2O8 |
| Molecular Weight | 607.14 g/mol |
| Exact Mass | 605.88 |
| IUPAC Name | carbon monoxide;cobalt;methyl 2-bromo-2-[(1R,2R)-2-(2-phenylethynyl)cyclopentyl]acetate |
| SMILES | COC(=O)C(Br)[C@@H]1CCC[C@H]1C#Cc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C16H17BrO2.6CO.2Co/c1-19-16(18)15(17)14-9-5-8-13(14)11-10-12-6-3-2-4-7-12;6*1-2;;/h2-4,6-7,13-15H,5,8-9H2,1H3;;;;;;;;/t13-,14+,15?;;;;;;;;/m0......../s1 |
| InChIKey | XEQNJKXYZMIWBD-MIVKCUBDSA-N |
| XLogP | 3.16 |
| TPSA | 145.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|