C17H23N3O3 — CID 110286160
(2S)-N-benzyl-1-(morpholine-4-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 110286160) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-N-benzyl-1-(morpholine-4-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-benzyl-1-(morpholine-4-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110286160 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (2S)-N-benzyl-1-(morpholine-4-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1CCCN1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H23N3O3/c21-16(18-13-14-5-2-1-3-6-14)15-7-4-8-20(15)17(22)19-9-11-23-12-10-19/h1-3,5-6,15H,4,7-13H2,(H,18,21)/t15-/m0/s1 |
| InChIKey | NZDXOOQGAYCDKK-HNNXBMFYSA-N |
| XLogP | 1.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |