C34H54O11 — CID 11028632
methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-9-(methoxymethoxy)-4,4,14-trimethyl-15-(oxan-2-yloxy)-3-oxopentadeca-5,7,13-trienoate (PubChem CID 11028632) has the molecular formula C34H54O11 and a molecular weight of 638.80 g/mol. Its IUPAC name is methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-9-(methoxymethoxy)-4,4,14-trimethyl-15-(oxan-2-yloxy)-3-oxopentadeca-5,7,13-trienoate.
| Compound Name | methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-9-(methoxymethoxy)-4,4,14-trimethyl-15-(oxan-2-yloxy)-3-oxopentadeca-5,7,13-trienoate |
|---|---|
| PubChem CID | 11028632 |
| Molecular Formula | C34H54O11 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-9-(methoxymethoxy)-4,4,14-trimethyl-15-(oxan-2-yloxy)-3-oxopentadeca-5,7,13-trienoate |
| SMILES | COCO[C@H](/C=C/C=C/C(C)(C)C(=O)CC(=O)OC)[C@@H](COC(=O)C(C)(C)C)CC(/C=C(\C)COC1CCCCO1)OC(C)=O |
| InChI | InChI=1S/C34H54O11/c1-24(21-42-31-15-11-13-17-41-31)18-27(45-25(2)35)19-26(22-43-32(38)33(3,4)5)28(44-23-39-8)14-10-12-16-34(6,7)29(36)20-30(37)40-9/h10,12,14,16,18,26-28,31H,11,13,15,17,19-23H2,1-9H3/b14-10+,16-12+,24-18+/t26-,27?,28-,31?/m1/s1 |
| InChIKey | KSJCBHKCOIPBPF-LIQMLYSLSA-N |
| XLogP | 5.26 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|