C20H23N3O3 — CID 110287044
phenyl N-[(1S)-2-(4-methylpiperazin-1-yl)-2-oxo-1-phenylethyl]carbamate (PubChem CID 110287044) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is phenyl N-[(1S)-2-(4-methylpiperazin-1-yl)-2-oxo-1-phenylethyl]carbamate.
| Compound Name | phenyl N-[(1S)-2-(4-methylpiperazin-1-yl)-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 110287044 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | phenyl N-[(1S)-2-(4-methylpiperazin-1-yl)-2-oxo-1-phenylethyl]carbamate |
| SMILES | CN1CCN(C(=O)[C@@H](NC(=O)Oc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N3O3/c1-22-12-14-23(15-13-22)19(24)18(16-8-4-2-5-9-16)21-20(25)26-17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3,(H,21,25)/t18-/m0/s1 |
| InChIKey | PGYKRGSNHSVZBP-SFHVURJKSA-N |
| XLogP | 2.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |