About Trimesitylsilane
Trimesitylsilane (PubChem CID 11028859) has the molecular formula C27H33Si
and a molecular weight of 385.65 g/mol.
Molecular Properties
| Compound Name | Trimesitylsilane |
|---|
| PubChem CID | 11028859 |
|---|
| Molecular Formula | C27H33Si |
|---|
| Molecular Weight | 385.65 g/mol |
|---|
| Exact Mass | 385.24 |
|---|
| IUPAC Name | — |
|---|
| SMILES | Cc1cc(C)c([Si](c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
|---|
| InChI | InChI=1S/C27H33Si/c1-16-10-19(4)25(20(5)11-16)28(26-21(6)12-17(2)13-22(26)7)27-23(8)14-18(3)15-24(27)9/h10-15H,1-9H3 |
|---|
| InChIKey | WBGARUFQIVNRHU-UHFFFAOYSA-N |
|---|
| XLogP | 4.98 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 28 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze Trimesitylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Trimesitylsilane?
The IUPAC name of Trimesitylsilane (CID 11028859) is not available.
What is the SMILES notation for Trimesitylsilane?
The canonical SMILES for Trimesitylsilane is Cc1cc(C)c([Si](c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of Trimesitylsilane?
The InChIKey is WBGARUFQIVNRHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33Si/c1-16-10-19(4)25(20(5)11-16)28(26-21(6)12-17(2)13-22(26)7)27-23(8)14-18(3)15-24(27)9/h10-15H,1-9H3.
What are the key properties of Trimesitylsilane?
Trimesitylsilane has a molecular weight of 385.65 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Trimesitylsilane is sourced from PubChem (CID 11028859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).