About cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone
cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone (PubChem CID 110289874) has the molecular formula C17H26N2OS
and a molecular weight of 306.47 g/mol. Its IUPAC name is cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone |
| PubChem CID | 110289874 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1nc(C2CCN(C(=O)C3CCCCC3)CC2)sc1C |
| InChI | InChI=1S/C17H26N2OS/c1-12-13(2)21-16(18-12)14-8-10-19(11-9-14)17(20)15-6-4-3-5-7-15/h14-15H,3-11H2,1-2H3 |
| InChIKey | GXEZYWVJZVKZSR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone?
The IUPAC name of cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone (CID 110289874) is cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone.
What is the SMILES notation for cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone?
The canonical SMILES for cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone is Cc1nc(C2CCN(C(=O)C3CCCCC3)CC2)sc1C.
What is the InChIKey of cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone?
The InChIKey is GXEZYWVJZVKZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2OS/c1-12-13(2)21-16(18-12)14-8-10-19(11-9-14)17(20)15-6-4-3-5-7-15/h14-15H,3-11H2,1-2H3.
What are the key properties of cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone?
cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone has a molecular weight of 306.47 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone is sourced from PubChem (CID 110289874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).