C16H22N2O3S — CID 110289985
ethyl 2-oxo-2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)piperidin-1-yl]acetate (PubChem CID 110289985) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 2-oxo-2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)piperidin-1-yl]acetate.
| Compound Name | ethyl 2-oxo-2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 110289985 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethyl 2-oxo-2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)piperidin-1-yl]acetate |
| SMILES | CCOC(=O)C(=O)N1CCC(c2nc3c(s2)CCCC3)CC1 |
| InChI | InChI=1S/C16H22N2O3S/c1-2-21-16(20)15(19)18-9-7-11(8-10-18)14-17-12-5-3-4-6-13(12)22-14/h11H,2-10H2,1H3 |
| InChIKey | NJFCNNMZWRYYON-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|