C14H19NO6S2 — CID 110290114
4-(4-methoxy-3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide (PubChem CID 110290114) has the molecular formula C14H19NO6S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 4-(4-methoxy-3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide.
| Compound Name | 4-(4-methoxy-3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
|---|---|
| PubChem CID | 110290114 |
| Molecular Formula | C14H19NO6S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-(4-methoxy-3-methylphenyl)sulfonyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b][1,4]oxazine 6,6-dioxide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOC3CS(=O)(=O)CC32)cc1C |
| InChI | InChI=1S/C14H19NO6S2/c1-10-7-11(3-4-13(10)20-2)23(18,19)15-5-6-21-14-9-22(16,17)8-12(14)15/h3-4,7,12,14H,5-6,8-9H2,1-2H3 |
| InChIKey | IEQRFJLGKNPYPP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |