C32H40F8NO8P — CID 11029031
(3,5-difluorophenyl)methyl-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-ylmethyl)azanium hexafluorophosphate (PubChem CID 11029031) has the molecular formula C32H40F8NO8P and a molecular weight of 749.63 g/mol. Its IUPAC name is (3,5-difluorophenyl)methyl-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-ylmethyl)azanium hexafluorophosphate.
| Compound Name | (3,5-difluorophenyl)methyl-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-ylmethyl)azanium hexafluorophosphate |
|---|---|
| PubChem CID | 11029031 |
| Molecular Formula | C32H40F8NO8P |
| Molecular Weight | 749.63 g/mol |
| Exact Mass | 749.24 |
| IUPAC Name | (3,5-difluorophenyl)methyl-(2,5,8,11,18,21,24,27-octaoxatricyclo[26.3.1.012,17]dotriaconta-1(32),12,14,16,28,30-hexaen-30-ylmethyl)azanium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.Fc1cc(F)cc(C[NH2+]Cc2cc3cc(c2)OCCOCCOCCOc2ccccc2OCCOCCOCCO3)c1 |
| InChI | InChI=1S/C32H39F2NO8.F6P/c33-27-17-25(18-28(34)21-27)23-35-24-26-19-29-22-30(20-26)41-14-10-37-6-8-39-12-16-43-32-4-2-1-3-31(32)42-15-11-38-7-5-36-9-13-40-29;1-7(2,3,4,5)6/h1-4,17-22,35H,5-16,23-24H2;/q;-1/p+1 |
| InChIKey | PCSBFBIWUOQKNW-UHFFFAOYSA-O |
| XLogP | 6.91 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|