C22H22FN3O3 — CID 110290620
2-[2-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 110290620) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-[2-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110290620 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-[2-[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H22FN3O3/c23-17-7-5-16(6-8-17)9-10-24-11-13-25(14-12-24)20(27)15-26-21(28)18-3-1-2-4-19(18)22(26)29/h1-8H,9-15H2 |
| InChIKey | NXKWVSXRSYBBAW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|