C19H28FN3O3S — CID 110290644
[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 110290644) has the molecular formula C19H28FN3O3S and a molecular weight of 397.52 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 110290644 |
| Molecular Formula | C19H28FN3O3S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CCN(CCc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C19H28FN3O3S/c1-27(25,26)23-10-7-17(8-11-23)19(24)22-14-12-21(13-15-22)9-6-16-2-4-18(20)5-3-16/h2-5,17H,6-15H2,1H3 |
| InChIKey | JQIBWVNWNUHJQP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |