C33H54O21 — CID 11029119
1,4,7,10,13,17,20,23,26,29,33,36,39,42,45-pentadecaoxacyclooctatetracontane-14,16,30,32,46,48-hexone (PubChem CID 11029119) has the molecular formula C33H54O21 and a molecular weight of 786.77 g/mol. Its IUPAC name is 1,4,7,10,13,17,20,23,26,29,33,36,39,42,45-pentadecaoxacyclooctatetracontane-14,16,30,32,46,48-hexone.
| Compound Name | 1,4,7,10,13,17,20,23,26,29,33,36,39,42,45-pentadecaoxacyclooctatetracontane-14,16,30,32,46,48-hexone |
|---|---|
| PubChem CID | 11029119 |
| Molecular Formula | C33H54O21 |
| Molecular Weight | 786.77 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | 1,4,7,10,13,17,20,23,26,29,33,36,39,42,45-pentadecaoxacyclooctatetracontane-14,16,30,32,46,48-hexone |
| SMILES | O=C1CC(=O)OCCOCCOCCOCCOC(=O)CC(=O)OCCOCCOCCOCCOC(=O)CC(=O)OCCOCCOCCOCCO1 |
| InChI | InChI=1S/C33H54O21/c34-28-25-29(35)51-21-15-45-9-3-41-5-11-47-17-23-53-32(38)27-33(39)54-24-18-48-12-6-42-4-10-46-16-22-52-31(37)26-30(36)50-20-14-44-8-2-40-1-7-43-13-19-49-28/h1-27H2 |
| InChIKey | QCRBILAHWCXXAE-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 240.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.77 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|