C16H16N2O6S — CID 110291824
2,5-dimethoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide (PubChem CID 110291824) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is 2,5-dimethoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110291824 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2,5-dimethoxy-N-(3-oxo-4H-1,4-benzoxazin-8-yl)benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2cccc3c2OCC(=O)N3)c1 |
| InChI | InChI=1S/C16H16N2O6S/c1-22-10-6-7-13(23-2)14(8-10)25(20,21)18-12-5-3-4-11-16(12)24-9-15(19)17-11/h3-8,18H,9H2,1-2H3,(H,17,19) |
| InChIKey | DKIMMTGPWAYRMC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |