C15H19N3O3 — CID 110292029
ethyl 2-[3-(2-methylbenzimidazol-1-yl)propylamino]-2-oxoacetate (PubChem CID 110292029) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 2-[3-(2-methylbenzimidazol-1-yl)propylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[3-(2-methylbenzimidazol-1-yl)propylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 110292029 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | ethyl 2-[3-(2-methylbenzimidazol-1-yl)propylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C15H19N3O3/c1-3-21-15(20)14(19)16-9-6-10-18-11(2)17-12-7-4-5-8-13(12)18/h4-5,7-8H,3,6,9-10H2,1-2H3,(H,16,19) |
| InChIKey | PSXJGLFUYQWKJC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|