C12H23NO2 — CID 110292524
N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide (PubChem CID 110292524) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide |
|---|---|
| PubChem CID | 110292524 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclohexyl]methyl]butanamide |
| SMILES | CCCC(=O)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-2-6-11(15)13-9-12(10-14)7-4-3-5-8-12/h14H,2-10H2,1H3,(H,13,15) |
| InChIKey | ZJWXARIDFKZIFV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |