C52H86N2O4S2+2 — CID 11029498
trimethyl-[6-[(1S,6S)-6-octoxycarbonyl-3-(4-octylphenyl)sulfanyl-4-[4-[4-(trimethylazaniumyl)butyl]phenyl]sulfanylcyclohex-3-ene-1-carbonyl]oxyhexyl]azanium (PubChem CID 11029498) has the molecular formula C52H86N2O4S2+2 and a molecular weight of 867.40 g/mol. Its IUPAC name is trimethyl-[6-[(1S,6S)-6-octoxycarbonyl-3-(4-octylphenyl)sulfanyl-4-[4-[4-(trimethylazaniumyl)butyl]phenyl]sulfanylcyclohex-3-ene-1-carbonyl]oxyhexyl]azanium.
| Compound Name | trimethyl-[6-[(1S,6S)-6-octoxycarbonyl-3-(4-octylphenyl)sulfanyl-4-[4-[4-(trimethylazaniumyl)butyl]phenyl]sulfanylcyclohex-3-ene-1-carbonyl]oxyhexyl]azanium |
|---|---|
| PubChem CID | 11029498 |
| Molecular Formula | C52H86N2O4S2+2 |
| Molecular Weight | 867.40 g/mol |
| Exact Mass | 866.60 |
| IUPAC Name | trimethyl-[6-[(1S,6S)-6-octoxycarbonyl-3-(4-octylphenyl)sulfanyl-4-[4-[4-(trimethylazaniumyl)butyl]phenyl]sulfanylcyclohex-3-ene-1-carbonyl]oxyhexyl]azanium |
| SMILES | CCCCCCCCOC(=O)[C@H]1CC(Sc2ccc(CCCC[N+](C)(C)C)cc2)=C(Sc2ccc(CCCCCCCC)cc2)C[C@@H]1C(=O)OCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C52H86N2O4S2/c1-9-11-13-15-17-21-27-43-29-33-45(34-30-43)59-49-42-48(52(56)58-40-26-20-18-23-37-53(3,4)5)47(51(55)57-39-25-19-16-14-12-10-2)41-50(49)60-46-35-31-44(32-36-46)28-22-24-38-54(6,7)8/h29-36,47-48H,9-28,37-42H2,1-8H3/q+2/t47-,48-/m0/s1 |
| InChIKey | HTAMNUFCBUYWKT-CRKOEVGVSA-N |
| XLogP | 13.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.40 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|