C16H22N2O5S2 — CID 110295552
3-(1,1-dioxothiazinan-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide (PubChem CID 110295552) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 110295552 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(1,1-dioxothiolan-3-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(N2CCCCS2(=O)=O)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O5S2/c1-17(15-7-10-24(20,21)12-15)16(19)13-5-4-6-14(11-13)18-8-2-3-9-25(18,22)23/h4-6,11,15H,2-3,7-10,12H2,1H3 |
| InChIKey | JPUHQJKBNGQVPY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |