C55H15AlF28 — CID 11029644
diphenylmethylbenzene;fluoro-tris[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]alumanuide (PubChem CID 11029644) has the molecular formula C55H15AlF28 and a molecular weight of 1234.65 g/mol. Its IUPAC name is diphenylmethylbenzene;fluoro-tris[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]alumanuide.
| Compound Name | diphenylmethylbenzene;fluoro-tris[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]alumanuide |
|---|---|
| PubChem CID | 11029644 |
| Molecular Formula | C55H15AlF28 |
| Molecular Weight | 1234.65 g/mol |
| Exact Mass | 1234.05 |
| IUPAC Name | diphenylmethylbenzene;fluoro-tris[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]alumanuide |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2[Al-](F)(c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.3C12F9.Al.FH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*13-3-1-2(5(14)9(18)6(3)15)4-7(16)10(19)12(21)11(20)8(4)17;;/h1-15H;;;;;1H/q+1;;;;;/p-1 |
| InChIKey | IDKRRUWXZVJGSP-UHFFFAOYSA-M |
| XLogP | 16.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1234.65 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|