About 5H-imidazo[4,5-c]pyridazine
5H-imidazo[4,5-c]pyridazine (PubChem CID 11029819) has the molecular formula C5H4N4
and a molecular weight of 120.11 g/mol. Its IUPAC name is 5H-imidazo[4,5-c]pyridazine.
Molecular Properties
| Compound Name | 5H-imidazo[4,5-c]pyridazine |
| PubChem CID | 11029819 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 5H-imidazo[4,5-c]pyridazine |
| SMILES | c1cc2[nH]cnc2nn1 |
| InChI | InChI=1S/C5H4N4/c1-2-8-9-5-4(1)6-3-7-5/h1-3H,(H,6,7,9) |
| InChIKey | MJQSRSOTRPMVKB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-imidazo[4,5-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-imidazo[4,5-c]pyridazine?
The IUPAC name of 5H-imidazo[4,5-c]pyridazine (CID 11029819) is 5H-imidazo[4,5-c]pyridazine.
What is the SMILES notation for 5H-imidazo[4,5-c]pyridazine?
The canonical SMILES for 5H-imidazo[4,5-c]pyridazine is c1cc2[nH]cnc2nn1.
What is the InChIKey of 5H-imidazo[4,5-c]pyridazine?
The InChIKey is MJQSRSOTRPMVKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4/c1-2-8-9-5-4(1)6-3-7-5/h1-3H,(H,6,7,9).
What are the key properties of 5H-imidazo[4,5-c]pyridazine?
5H-imidazo[4,5-c]pyridazine has a molecular weight of 120.11 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-imidazo[4,5-c]pyridazine is sourced from PubChem (CID 11029819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).