About (8S)-5,6,7,8-tetrahydropyrrolizin-3-one
(8S)-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 11029828) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (8S)-5,6,7,8-tetrahydropyrrolizin-3-one.
Molecular Properties
| Compound Name | (8S)-5,6,7,8-tetrahydropyrrolizin-3-one |
| PubChem CID | 11029828 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (8S)-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | O=C1C=C[C@@H]2CCCN12 |
| InChI | InChI=1S/C7H9NO/c9-7-4-3-6-2-1-5-8(6)7/h3-4,6H,1-2,5H2/t6-/m0/s1 |
| InChIKey | FVZBHZCORGROSI-LURJTMIESA-N |
| XLogP | 0.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8S)-5,6,7,8-tetrahydropyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-5,6,7,8-tetrahydropyrrolizin-3-one?
The IUPAC name of (8S)-5,6,7,8-tetrahydropyrrolizin-3-one (CID 11029828) is (8S)-5,6,7,8-tetrahydropyrrolizin-3-one.
What is the SMILES notation for (8S)-5,6,7,8-tetrahydropyrrolizin-3-one?
The canonical SMILES for (8S)-5,6,7,8-tetrahydropyrrolizin-3-one is O=C1C=C[C@@H]2CCCN12.
What is the InChIKey of (8S)-5,6,7,8-tetrahydropyrrolizin-3-one?
The InChIKey is FVZBHZCORGROSI-LURJTMIESA-N. The full InChI is InChI=1S/C7H9NO/c9-7-4-3-6-2-1-5-8(6)7/h3-4,6H,1-2,5H2/t6-/m0/s1.
What are the key properties of (8S)-5,6,7,8-tetrahydropyrrolizin-3-one?
(8S)-5,6,7,8-tetrahydropyrrolizin-3-one has a molecular weight of 123.15 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-5,6,7,8-tetrahydropyrrolizin-3-one is sourced from PubChem (CID 11029828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).