About 3,3-dimethoxypyrrolidine
3,3-dimethoxypyrrolidine (PubChem CID 11029882) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 3,3-dimethoxypyrrolidine.
Molecular Properties
| Compound Name | 3,3-dimethoxypyrrolidine |
| PubChem CID | 11029882 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3,3-dimethoxypyrrolidine |
| SMILES | COC1(OC)CCNC1 |
| InChI | InChI=1S/C6H13NO2/c1-8-6(9-2)3-4-7-5-6/h7H,3-5H2,1-2H3 |
| InChIKey | NGUZLZRQOZXVSQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethoxypyrrolidine?
The IUPAC name of 3,3-dimethoxypyrrolidine (CID 11029882) is 3,3-dimethoxypyrrolidine.
What is the SMILES notation for 3,3-dimethoxypyrrolidine?
The canonical SMILES for 3,3-dimethoxypyrrolidine is COC1(OC)CCNC1.
What is the InChIKey of 3,3-dimethoxypyrrolidine?
The InChIKey is NGUZLZRQOZXVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-8-6(9-2)3-4-7-5-6/h7H,3-5H2,1-2H3.
What are the key properties of 3,3-dimethoxypyrrolidine?
3,3-dimethoxypyrrolidine has a molecular weight of 131.18 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethoxypyrrolidine is sourced from PubChem (CID 11029882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).