About 2-propylhexanal
2-propylhexanal (PubChem CID 11029945) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2-propylhexanal.
Molecular Properties
| Compound Name | 2-propylhexanal |
| PubChem CID | 11029945 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2-propylhexanal |
| SMILES | CCCCC(C=O)CCC |
| InChI | InChI=1S/C9H18O/c1-3-5-7-9(8-10)6-4-2/h8-9H,3-7H2,1-2H3 |
| InChIKey | IREORVYCKDQFMD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-propylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylhexanal?
The IUPAC name of 2-propylhexanal (CID 11029945) is 2-propylhexanal.
What is the SMILES notation for 2-propylhexanal?
The canonical SMILES for 2-propylhexanal is CCCCC(C=O)CCC.
What is the InChIKey of 2-propylhexanal?
The InChIKey is IREORVYCKDQFMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-5-7-9(8-10)6-4-2/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-propylhexanal?
2-propylhexanal has a molecular weight of 142.24 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylhexanal is sourced from PubChem (CID 11029945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).