About N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine
N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine (PubChem CID 11030010) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine |
| PubChem CID | 11030010 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine |
| SMILES | C#CC(C)CN(C)C/C=C/C |
| InChI | InChI=1S/C10H17N/c1-5-7-8-11(4)9-10(3)6-2/h2,5,7,10H,8-9H2,1,3-4H3/b7-5+ |
| InChIKey | HSEJUSYCSBLLMA-FNORWQNLSA-N |
| XLogP | 1.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine?
The IUPAC name of N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine (CID 11030010) is N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine.
What is the SMILES notation for N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine?
The canonical SMILES for N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine is C#CC(C)CN(C)C/C=C/C.
What is the InChIKey of N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine?
The InChIKey is HSEJUSYCSBLLMA-FNORWQNLSA-N. The full InChI is InChI=1S/C10H17N/c1-5-7-8-11(4)9-10(3)6-2/h2,5,7,10H,8-9H2,1,3-4H3/b7-5+.
What are the key properties of N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine?
N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine has a molecular weight of 151.25 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]-N,2-dimethylbut-3-yn-1-amine is sourced from PubChem (CID 11030010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).