C20H17N5O — CID 110300421
N-(2-ethylphenyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide (PubChem CID 110300421) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide.
| Compound Name | N-(2-ethylphenyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 110300421 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(2-ethylphenyl)-4-([1,2,4]triazolo[4,3-a]pyrimidin-3-yl)benzamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc(-c2nnc3ncccn23)cc1 |
| InChI | InChI=1S/C20H17N5O/c1-2-14-6-3-4-7-17(14)22-19(26)16-10-8-15(9-11-16)18-23-24-20-21-12-5-13-25(18)20/h3-13H,2H2,1H3,(H,22,26) |
| InChIKey | RPCJXGWKLBSGDC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |