About 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one
1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one (PubChem CID 11030063) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one |
| PubChem CID | 11030063 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@@H]1C[C@@H]1CO |
| InChI | InChI=1S/C9H16O2/c1-9(2,3)8(11)7-4-6(7)5-10/h6-7,10H,4-5H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | BMQUNCVYHJMXJR-RNFRBKRXSA-N |
| XLogP | 1.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one (CID 11030063) is 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)[C@@H]1C[C@@H]1CO.
What is the InChIKey of 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one?
The InChIKey is BMQUNCVYHJMXJR-RNFRBKRXSA-N. The full InChI is InChI=1S/C9H16O2/c1-9(2,3)8(11)7-4-6(7)5-10/h6-7,10H,4-5H2,1-3H3/t6-,7-/m1/s1.
What are the key properties of 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one?
1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one has a molecular weight of 156.22 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-2-(hydroxymethyl)cyclopropyl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 11030063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).