C7H13NO3 — CID 11030102
(1S,2R,3R,5S,6R)-8-azabicyclo[3.2.1]octane-2,3,6-triol (PubChem CID 11030102) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (1S,2R,3R,5S,6R)-8-azabicyclo[3.2.1]octane-2,3,6-triol.
| Compound Name | (1S,2R,3R,5S,6R)-8-azabicyclo[3.2.1]octane-2,3,6-triol |
|---|---|
| PubChem CID | 11030102 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (1S,2R,3R,5S,6R)-8-azabicyclo[3.2.1]octane-2,3,6-triol |
| SMILES | O[C@H]1[C@H](O)C[C@@H]2N[C@H]1C[C@H]2O |
| InChI | InChI=1S/C7H13NO3/c9-5-2-4-7(11)6(10)1-3(5)8-4/h3-11H,1-2H2/t3-,4-,5+,6+,7+/m0/s1 |
| InChIKey | MOPMNYGCKDMKSI-PAMBMQIZSA-N |
| XLogP | -1.80 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |