C23H30N2O — CID 110301638
2-methyl-2,3-diphenyl-N-(2-pyrrolidin-1-ylpropyl)propanamide (PubChem CID 110301638) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-methyl-2,3-diphenyl-N-(2-pyrrolidin-1-ylpropyl)propanamide.
| Compound Name | 2-methyl-2,3-diphenyl-N-(2-pyrrolidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 110301638 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-methyl-2,3-diphenyl-N-(2-pyrrolidin-1-ylpropyl)propanamide |
| SMILES | CC(CNC(=O)C(C)(Cc1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C23H30N2O/c1-19(25-15-9-10-16-25)18-24-22(26)23(2,21-13-7-4-8-14-21)17-20-11-5-3-6-12-20/h3-8,11-14,19H,9-10,15-18H2,1-2H3,(H,24,26) |
| InChIKey | STHWZXHAOYWTKJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |