About 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one
6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one (PubChem CID 11030209) has the molecular formula C8H6FNO2
and a molecular weight of 167.14 g/mol. Its IUPAC name is 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one |
| PubChem CID | 11030209 |
| Molecular Formula | C8H6FNO2 |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1c(F)ccc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C8H6FNO2/c1-4-5(9)2-3-6-7(4)12-8(11)10-6/h2-3H,1H3,(H,10,11) |
| InChIKey | WZBDBQXTTQASQA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one?
The IUPAC name of 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one (CID 11030209) is 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one is Cc1c(F)ccc2[nH]c(=O)oc12.
What is the InChIKey of 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one?
The InChIKey is WZBDBQXTTQASQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO2/c1-4-5(9)2-3-6-7(4)12-8(11)10-6/h2-3H,1H3,(H,10,11).
What are the key properties of 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one?
6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one has a molecular weight of 167.14 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-methyl-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 11030209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).