C21H26N2O2 — CID 110302493
(E)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpent-2-enamide (PubChem CID 110302493) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (E)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpent-2-enamide.
| Compound Name | (E)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpent-2-enamide |
|---|---|
| PubChem CID | 110302493 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (E)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpent-2-enamide |
| SMILES | CC/C(=C\C(=O)NCC(c1ccco1)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-2-17(18-9-4-3-5-10-18)15-21(24)22-16-19(20-11-8-14-25-20)23-12-6-7-13-23/h3-5,8-11,14-15,19H,2,6-7,12-13,16H2,1H3,(H,22,24)/b17-15+ |
| InChIKey | VTBYVOIBWMAFJU-BMRADRMJSA-N |
| XLogP | 4.03 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|