C9H14O3 — CID 11030265
(3R)-2-(1,3-dioxolan-2-yl)-3-methylcyclopentan-1-one (PubChem CID 11030265) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3R)-2-(1,3-dioxolan-2-yl)-3-methylcyclopentan-1-one.
| Compound Name | (3R)-2-(1,3-dioxolan-2-yl)-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 11030265 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3R)-2-(1,3-dioxolan-2-yl)-3-methylcyclopentan-1-one |
| SMILES | C[C@@H]1CCC(=O)C1C1OCCO1 |
| InChI | InChI=1S/C9H14O3/c1-6-2-3-7(10)8(6)9-11-4-5-12-9/h6,8-9H,2-5H2,1H3/t6-,8?/m1/s1 |
| InChIKey | UYFISCLSHRKKNS-XPJFZRNWSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |