About 5,6-dihydrothieno[2,3-b]thiopyran-4-one
5,6-dihydrothieno[2,3-b]thiopyran-4-one (PubChem CID 11030274) has the molecular formula C7H6OS2
and a molecular weight of 170.26 g/mol. Its IUPAC name is 5,6-dihydrothieno[2,3-b]thiopyran-4-one.
Molecular Properties
| Compound Name | 5,6-dihydrothieno[2,3-b]thiopyran-4-one |
| PubChem CID | 11030274 |
| Molecular Formula | C7H6OS2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 5,6-dihydrothieno[2,3-b]thiopyran-4-one |
| SMILES | O=C1CCSc2sccc21 |
| InChI | InChI=1S/C7H6OS2/c8-6-2-4-10-7-5(6)1-3-9-7/h1,3H,2,4H2 |
| InChIKey | QHIWYFNTGCSHTG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydrothieno[2,3-b]thiopyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrothieno[2,3-b]thiopyran-4-one?
The IUPAC name of 5,6-dihydrothieno[2,3-b]thiopyran-4-one (CID 11030274) is 5,6-dihydrothieno[2,3-b]thiopyran-4-one.
What is the SMILES notation for 5,6-dihydrothieno[2,3-b]thiopyran-4-one?
The canonical SMILES for 5,6-dihydrothieno[2,3-b]thiopyran-4-one is O=C1CCSc2sccc21.
What is the InChIKey of 5,6-dihydrothieno[2,3-b]thiopyran-4-one?
The InChIKey is QHIWYFNTGCSHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6OS2/c8-6-2-4-10-7-5(6)1-3-9-7/h1,3H,2,4H2.
What are the key properties of 5,6-dihydrothieno[2,3-b]thiopyran-4-one?
5,6-dihydrothieno[2,3-b]thiopyran-4-one has a molecular weight of 170.26 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrothieno[2,3-b]thiopyran-4-one is sourced from PubChem (CID 11030274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).