About 4-benzyl-4H-pyran
4-benzyl-4H-pyran (PubChem CID 11030295) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-benzyl-4H-pyran.
Molecular Properties
| Compound Name | 4-benzyl-4H-pyran |
| PubChem CID | 11030295 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 4-benzyl-4H-pyran |
| SMILES | C1=CC(Cc2ccccc2)C=CO1 |
| InChI | InChI=1S/C12H12O/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-9,12H,10H2 |
| InChIKey | IJJWPWUVXAQDNR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-benzyl-4H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-4H-pyran?
The IUPAC name of 4-benzyl-4H-pyran (CID 11030295) is 4-benzyl-4H-pyran.
What is the SMILES notation for 4-benzyl-4H-pyran?
The canonical SMILES for 4-benzyl-4H-pyran is C1=CC(Cc2ccccc2)C=CO1.
What is the InChIKey of 4-benzyl-4H-pyran?
The InChIKey is IJJWPWUVXAQDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-9,12H,10H2.
What are the key properties of 4-benzyl-4H-pyran?
4-benzyl-4H-pyran has a molecular weight of 172.23 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-4H-pyran is sourced from PubChem (CID 11030295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).