About 5-methylpyrido[4,3-b]indole
5-methylpyrido[4,3-b]indole (PubChem CID 11030447) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-methylpyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 5-methylpyrido[4,3-b]indole |
| PubChem CID | 11030447 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5-methylpyrido[4,3-b]indole |
| SMILES | Cn1c2ccccc2c2cnccc21 |
| InChI | InChI=1S/C12H10N2/c1-14-11-5-3-2-4-9(11)10-8-13-7-6-12(10)14/h2-8H,1H3 |
| InChIKey | OSJLOPGPFMIKTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylpyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrido[4,3-b]indole?
The IUPAC name of 5-methylpyrido[4,3-b]indole (CID 11030447) is 5-methylpyrido[4,3-b]indole.
What is the SMILES notation for 5-methylpyrido[4,3-b]indole?
The canonical SMILES for 5-methylpyrido[4,3-b]indole is Cn1c2ccccc2c2cnccc21.
What is the InChIKey of 5-methylpyrido[4,3-b]indole?
The InChIKey is OSJLOPGPFMIKTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-14-11-5-3-2-4-9(11)10-8-13-7-6-12(10)14/h2-8H,1H3.
What are the key properties of 5-methylpyrido[4,3-b]indole?
5-methylpyrido[4,3-b]indole has a molecular weight of 182.23 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrido[4,3-b]indole is sourced from PubChem (CID 11030447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).