C10H18OSi — CID 11030466
[(1S,4R)-2-bicyclo[2.2.1]hept-2-enyl]oxy-trimethylsilane (PubChem CID 11030466) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is [(1S,4R)-2-bicyclo[2.2.1]hept-2-enyl]oxy-trimethylsilane.
| Compound Name | [(1S,4R)-2-bicyclo[2.2.1]hept-2-enyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11030466 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | [(1S,4R)-2-bicyclo[2.2.1]hept-2-enyl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C10H18OSi/c1-12(2,3)11-10-7-8-4-5-9(10)6-8/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | LWEGGUCCOPWRNB-BDAKNGLRSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|