About ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate
ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate (PubChem CID 11030517) has the molecular formula C6H9F3O3
and a molecular weight of 186.13 g/mol. Its IUPAC name is ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate.
Molecular Properties
| Compound Name | ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate |
| PubChem CID | 11030517 |
| Molecular Formula | C6H9F3O3 |
| Molecular Weight | 186.13 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate |
| SMILES | CCOC(=O)[C@](C)(O)C(F)(F)F |
| InChI | InChI=1S/C6H9F3O3/c1-3-12-4(10)5(2,11)6(7,8)9/h11H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | HUCCJSWZXCFGFK-YFKPBYRVSA-N |
| XLogP | 0.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.13 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate?
The IUPAC name of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate (CID 11030517) is ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate.
What is the SMILES notation for ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate?
The canonical SMILES for ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is CCOC(=O)[C@](C)(O)C(F)(F)F.
What is the InChIKey of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate?
The InChIKey is HUCCJSWZXCFGFK-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9F3O3/c1-3-12-4(10)5(2,11)6(7,8)9/h11H,3H2,1-2H3/t5-/m0/s1.
What are the key properties of ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate?
ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate has a molecular weight of 186.13 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoate is sourced from PubChem (CID 11030517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).