C21H18N4OS — CID 110305177
N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]-3-pyrrol-1-ylbenzamide (PubChem CID 110305177) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 110305177 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]-3-pyrrol-1-ylbenzamide |
| SMILES | O=C(NCCc1csc(-c2cccnc2)n1)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C21H18N4OS/c26-20(16-5-3-7-19(13-16)25-11-1-2-12-25)23-10-8-18-15-27-21(24-18)17-6-4-9-22-14-17/h1-7,9,11-15H,8,10H2,(H,23,26) |
| InChIKey | LPLXQPAAGLETHU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |