About 2-hydroxy-1,1,3,3-tetramethylisoindole
2-hydroxy-1,1,3,3-tetramethylisoindole (PubChem CID 11030629) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-hydroxy-1,1,3,3-tetramethylisoindole.
Molecular Properties
| Compound Name | 2-hydroxy-1,1,3,3-tetramethylisoindole |
| PubChem CID | 11030629 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-hydroxy-1,1,3,3-tetramethylisoindole |
| SMILES | CC1(C)c2ccccc2C(C)(C)N1O |
| InChI | InChI=1S/C12H17NO/c1-11(2)9-7-5-6-8-10(9)12(3,4)13(11)14/h5-8,14H,1-4H3 |
| InChIKey | YLUNMWQQDYDAJP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-1,1,3,3-tetramethylisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1,1,3,3-tetramethylisoindole?
The IUPAC name of 2-hydroxy-1,1,3,3-tetramethylisoindole (CID 11030629) is 2-hydroxy-1,1,3,3-tetramethylisoindole.
What is the SMILES notation for 2-hydroxy-1,1,3,3-tetramethylisoindole?
The canonical SMILES for 2-hydroxy-1,1,3,3-tetramethylisoindole is CC1(C)c2ccccc2C(C)(C)N1O.
What is the InChIKey of 2-hydroxy-1,1,3,3-tetramethylisoindole?
The InChIKey is YLUNMWQQDYDAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-11(2)9-7-5-6-8-10(9)12(3,4)13(11)14/h5-8,14H,1-4H3.
What are the key properties of 2-hydroxy-1,1,3,3-tetramethylisoindole?
2-hydroxy-1,1,3,3-tetramethylisoindole has a molecular weight of 191.27 g/mol, XLogP of 2.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1,1,3,3-tetramethylisoindole is sourced from PubChem (CID 11030629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).