About 3-chloro-6-phenyl-1,2,4-triazine
3-chloro-6-phenyl-1,2,4-triazine (PubChem CID 11030632) has the molecular formula C9H6ClN3
and a molecular weight of 191.62 g/mol. Its IUPAC name is 3-chloro-6-phenyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-chloro-6-phenyl-1,2,4-triazine |
| PubChem CID | 11030632 |
| Molecular Formula | C9H6ClN3 |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 3-chloro-6-phenyl-1,2,4-triazine |
| SMILES | Clc1ncc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C9H6ClN3/c10-9-11-6-8(12-13-9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | POSVMUJKVDQWHT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-6-phenyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-phenyl-1,2,4-triazine?
The IUPAC name of 3-chloro-6-phenyl-1,2,4-triazine (CID 11030632) is 3-chloro-6-phenyl-1,2,4-triazine.
What is the SMILES notation for 3-chloro-6-phenyl-1,2,4-triazine?
The canonical SMILES for 3-chloro-6-phenyl-1,2,4-triazine is Clc1ncc(-c2ccccc2)nn1.
What is the InChIKey of 3-chloro-6-phenyl-1,2,4-triazine?
The InChIKey is POSVMUJKVDQWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN3/c10-9-11-6-8(12-13-9)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 3-chloro-6-phenyl-1,2,4-triazine?
3-chloro-6-phenyl-1,2,4-triazine has a molecular weight of 191.62 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-phenyl-1,2,4-triazine is sourced from PubChem (CID 11030632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).