C21H24ClNO3 — CID 110307812
4-(4-chlorophenyl)-N-[4-(4-methoxyphenyl)butyl]-4-oxobutanamide (PubChem CID 110307812) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-(4-methoxyphenyl)butyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[4-(4-methoxyphenyl)butyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110307812 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-(4-methoxyphenyl)butyl]-4-oxobutanamide |
| SMILES | COc1ccc(CCCCNC(=O)CCC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H24ClNO3/c1-26-19-11-5-16(6-12-19)4-2-3-15-23-21(25)14-13-20(24)17-7-9-18(22)10-8-17/h5-12H,2-4,13-15H2,1H3,(H,23,25) |
| InChIKey | HFGDCPUQCHGHBY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|